C21H27NO5S — CID 110551030
3-(2-hydroxyethylsulfanyl)-4-[4-(2-methylpropoxy)phenyl]-1-(oxolan-2-ylmethyl)pyrrole-2,5-dione (PubChem CID 110551030) has the molecular formula C21H27NO5S and a molecular weight of 405.52 g/mol. Its IUPAC name is 3-(2-hydroxyethylsulfanyl)-4-[4-(2-methylpropoxy)phenyl]-1-(oxolan-2-ylmethyl)pyrrole-2,5-dione.
| Compound Name | 3-(2-hydroxyethylsulfanyl)-4-[4-(2-methylpropoxy)phenyl]-1-(oxolan-2-ylmethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110551030 |
| Molecular Formula | C21H27NO5S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 3-(2-hydroxyethylsulfanyl)-4-[4-(2-methylpropoxy)phenyl]-1-(oxolan-2-ylmethyl)pyrrole-2,5-dione |
| SMILES | CC(C)COc1ccc(C2=C(SCCO)C(=O)N(CC3CCCO3)C2=O)cc1 |
| InChI | InChI=1S/C21H27NO5S/c1-14(2)13-27-16-7-5-15(6-8-16)18-19(28-11-9-23)21(25)22(20(18)24)12-17-4-3-10-26-17/h5-8,14,17,23H,3-4,9-13H2,1-2H3 |
| InChIKey | SVJVIHPUKUJBSG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|