C15H16O4 — CID 11054395
methyl (2S)-2-hydroxy-2-[(1S)-2-oxocyclohex-3-en-1-yl]-2-phenylacetate (PubChem CID 11054395) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is methyl (2S)-2-hydroxy-2-[(1S)-2-oxocyclohex-3-en-1-yl]-2-phenylacetate.
| Compound Name | methyl (2S)-2-hydroxy-2-[(1S)-2-oxocyclohex-3-en-1-yl]-2-phenylacetate |
|---|---|
| PubChem CID | 11054395 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | methyl (2S)-2-hydroxy-2-[(1S)-2-oxocyclohex-3-en-1-yl]-2-phenylacetate |
| SMILES | COC(=O)[C@@](O)(c1ccccc1)[C@@H]1CCC=CC1=O |
| InChI | InChI=1S/C15H16O4/c1-19-14(17)15(18,11-7-3-2-4-8-11)12-9-5-6-10-13(12)16/h2-4,6-8,10,12,18H,5,9H2,1H3/t12-,15-/m1/s1 |
| InChIKey | QUJVDIUILHTLMV-IUODEOHRSA-N |
| XLogP | 1.58 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |