C22H21FN2O3 — CID 110544608
1-(3,5-dimethylphenyl)-3-(4-fluorophenyl)-4-morpholin-4-ylpyrrole-2,5-dione (PubChem CID 110544608) has the molecular formula C22H21FN2O3 and a molecular weight of 380.42 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-(4-fluorophenyl)-4-morpholin-4-ylpyrrole-2,5-dione.
| Compound Name | 1-(3,5-dimethylphenyl)-3-(4-fluorophenyl)-4-morpholin-4-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110544608 |
| Molecular Formula | C22H21FN2O3 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-(4-fluorophenyl)-4-morpholin-4-ylpyrrole-2,5-dione |
| SMILES | Cc1cc(C)cc(N2C(=O)C(c3ccc(F)cc3)=C(N3CCOCC3)C2=O)c1 |
| InChI | InChI=1S/C22H21FN2O3/c1-14-11-15(2)13-18(12-14)25-21(26)19(16-3-5-17(23)6-4-16)20(22(25)27)24-7-9-28-10-8-24/h3-6,11-13H,7-10H2,1-2H3 |
| InChIKey | XRHAIZYMRNZFES-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|