C23H23FN2O2 — CID 110545069
1-(2,3-dimethylphenyl)-3-(4-fluorophenyl)-4-piperidin-1-ylpyrrole-2,5-dione (PubChem CID 110545069) has the molecular formula C23H23FN2O2 and a molecular weight of 378.45 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3-(4-fluorophenyl)-4-piperidin-1-ylpyrrole-2,5-dione.
| Compound Name | 1-(2,3-dimethylphenyl)-3-(4-fluorophenyl)-4-piperidin-1-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110545069 |
| Molecular Formula | C23H23FN2O2 |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3-(4-fluorophenyl)-4-piperidin-1-ylpyrrole-2,5-dione |
| SMILES | Cc1cccc(N2C(=O)C(c3ccc(F)cc3)=C(N3CCCCC3)C2=O)c1C |
| InChI | InChI=1S/C23H23FN2O2/c1-15-7-6-8-19(16(15)2)26-22(27)20(17-9-11-18(24)12-10-17)21(23(26)28)25-13-4-3-5-14-25/h6-12H,3-5,13-14H2,1-2H3 |
| InChIKey | YIWAZUHPAJLHMN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|