C25H29NO4S — CID 110546836
1-cyclooctyl-3-(4-ethoxyphenyl)-4-(furan-2-ylmethylsulfanyl)pyrrole-2,5-dione (PubChem CID 110546836) has the molecular formula C25H29NO4S and a molecular weight of 439.58 g/mol. Its IUPAC name is 1-cyclooctyl-3-(4-ethoxyphenyl)-4-(furan-2-ylmethylsulfanyl)pyrrole-2,5-dione.
| Compound Name | 1-cyclooctyl-3-(4-ethoxyphenyl)-4-(furan-2-ylmethylsulfanyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110546836 |
| Molecular Formula | C25H29NO4S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 1-cyclooctyl-3-(4-ethoxyphenyl)-4-(furan-2-ylmethylsulfanyl)pyrrole-2,5-dione |
| SMILES | CCOc1ccc(C2=C(SCc3ccco3)C(=O)N(C3CCCCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C25H29NO4S/c1-2-29-20-14-12-18(13-15-20)22-23(31-17-21-11-8-16-30-21)25(28)26(24(22)27)19-9-6-4-3-5-7-10-19/h8,11-16,19H,2-7,9-10,17H2,1H3 |
| InChIKey | SGACPOQHZFKJQD-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|