C24H26N2O4S — CID 110562838
N-[4-[1-cycloheptyl-4-(furan-2-ylmethylsulfanyl)-2,5-dioxopyrrol-3-yl]phenyl]acetamide (PubChem CID 110562838) has the molecular formula C24H26N2O4S and a molecular weight of 438.55 g/mol. Its IUPAC name is N-[4-[1-cycloheptyl-4-(furan-2-ylmethylsulfanyl)-2,5-dioxopyrrol-3-yl]phenyl]acetamide.
| Compound Name | N-[4-[1-cycloheptyl-4-(furan-2-ylmethylsulfanyl)-2,5-dioxopyrrol-3-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 110562838 |
| Molecular Formula | C24H26N2O4S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | N-[4-[1-cycloheptyl-4-(furan-2-ylmethylsulfanyl)-2,5-dioxopyrrol-3-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C2=C(SCc3ccco3)C(=O)N(C3CCCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C24H26N2O4S/c1-16(27)25-18-12-10-17(11-13-18)21-22(31-15-20-9-6-14-30-20)24(29)26(23(21)28)19-7-4-2-3-5-8-19/h6,9-14,19H,2-5,7-8,15H2,1H3,(H,25,27) |
| InChIKey | MBWATEUTNMMOCA-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|