C25H26F2N2O3 — CID 110548061
1-(3,4-difluorophenyl)-3-(3,5-dimethylpiperidin-1-yl)-4-(4-ethoxyphenyl)pyrrole-2,5-dione (PubChem CID 110548061) has the molecular formula C25H26F2N2O3 and a molecular weight of 440.49 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-(3,5-dimethylpiperidin-1-yl)-4-(4-ethoxyphenyl)pyrrole-2,5-dione.
| Compound Name | 1-(3,4-difluorophenyl)-3-(3,5-dimethylpiperidin-1-yl)-4-(4-ethoxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110548061 |
| Molecular Formula | C25H26F2N2O3 |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-(3,5-dimethylpiperidin-1-yl)-4-(4-ethoxyphenyl)pyrrole-2,5-dione |
| SMILES | CCOc1ccc(C2=C(N3CC(C)CC(C)C3)C(=O)N(c3ccc(F)c(F)c3)C2=O)cc1 |
| InChI | InChI=1S/C25H26F2N2O3/c1-4-32-19-8-5-17(6-9-19)22-23(28-13-15(2)11-16(3)14-28)25(31)29(24(22)30)18-7-10-20(26)21(27)12-18/h5-10,12,15-16H,4,11,13-14H2,1-3H3 |
| InChIKey | UJBUCETZZKTJQH-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|