C28H34N2O3 — CID 110551828
3-(3,5-dimethylpiperidin-1-yl)-1-(4-methylphenyl)-4-[4-(2-methylpropoxy)phenyl]pyrrole-2,5-dione (PubChem CID 110551828) has the molecular formula C28H34N2O3 and a molecular weight of 446.59 g/mol. Its IUPAC name is 3-(3,5-dimethylpiperidin-1-yl)-1-(4-methylphenyl)-4-[4-(2-methylpropoxy)phenyl]pyrrole-2,5-dione.
| Compound Name | 3-(3,5-dimethylpiperidin-1-yl)-1-(4-methylphenyl)-4-[4-(2-methylpropoxy)phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110551828 |
| Molecular Formula | C28H34N2O3 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | 3-(3,5-dimethylpiperidin-1-yl)-1-(4-methylphenyl)-4-[4-(2-methylpropoxy)phenyl]pyrrole-2,5-dione |
| SMILES | Cc1ccc(N2C(=O)C(c3ccc(OCC(C)C)cc3)=C(N3CC(C)CC(C)C3)C2=O)cc1 |
| InChI | InChI=1S/C28H34N2O3/c1-18(2)17-33-24-12-8-22(9-13-24)25-26(29-15-20(4)14-21(5)16-29)28(32)30(27(25)31)23-10-6-19(3)7-11-23/h6-13,18,20-21H,14-17H2,1-5H3 |
| InChIKey | RGFPEHFICPMZJM-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|