C27H32N2O4 — CID 110551810
3-(2,6-dimethylmorpholin-4-yl)-1-(3-methylphenyl)-4-[4-(2-methylpropoxy)phenyl]pyrrole-2,5-dione (PubChem CID 110551810) has the molecular formula C27H32N2O4 and a molecular weight of 448.56 g/mol. Its IUPAC name is 3-(2,6-dimethylmorpholin-4-yl)-1-(3-methylphenyl)-4-[4-(2-methylpropoxy)phenyl]pyrrole-2,5-dione.
| Compound Name | 3-(2,6-dimethylmorpholin-4-yl)-1-(3-methylphenyl)-4-[4-(2-methylpropoxy)phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110551810 |
| Molecular Formula | C27H32N2O4 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 3-(2,6-dimethylmorpholin-4-yl)-1-(3-methylphenyl)-4-[4-(2-methylpropoxy)phenyl]pyrrole-2,5-dione |
| SMILES | Cc1cccc(N2C(=O)C(c3ccc(OCC(C)C)cc3)=C(N3CC(C)OC(C)C3)C2=O)c1 |
| InChI | InChI=1S/C27H32N2O4/c1-17(2)16-32-23-11-9-21(10-12-23)24-25(28-14-19(4)33-20(5)15-28)27(31)29(26(24)30)22-8-6-7-18(3)13-22/h6-13,17,19-20H,14-16H2,1-5H3 |
| InChIKey | XILAFMDXFYOIQS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|