C27H38N2O4 — CID 110551394
1-cycloheptyl-3-(2,6-dimethylmorpholin-4-yl)-4-[4-(2-methylpropoxy)phenyl]pyrrole-2,5-dione (PubChem CID 110551394) has the molecular formula C27H38N2O4 and a molecular weight of 454.61 g/mol. Its IUPAC name is 1-cycloheptyl-3-(2,6-dimethylmorpholin-4-yl)-4-[4-(2-methylpropoxy)phenyl]pyrrole-2,5-dione.
| Compound Name | 1-cycloheptyl-3-(2,6-dimethylmorpholin-4-yl)-4-[4-(2-methylpropoxy)phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110551394 |
| Molecular Formula | C27H38N2O4 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | 1-cycloheptyl-3-(2,6-dimethylmorpholin-4-yl)-4-[4-(2-methylpropoxy)phenyl]pyrrole-2,5-dione |
| SMILES | CC(C)COc1ccc(C2=C(N3CC(C)OC(C)C3)C(=O)N(C3CCCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C27H38N2O4/c1-18(2)17-32-23-13-11-21(12-14-23)24-25(28-15-19(3)33-20(4)16-28)27(31)29(26(24)30)22-9-7-5-6-8-10-22/h11-14,18-20,22H,5-10,15-17H2,1-4H3 |
| InChIKey | ZXWGXOCUNSVJJU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|