C24H32N2O3 — CID 110572643
1-cycloheptyl-3-(2,6-dimethylmorpholin-4-yl)-4-(4-methylphenyl)pyrrole-2,5-dione (PubChem CID 110572643) has the molecular formula C24H32N2O3 and a molecular weight of 396.53 g/mol. Its IUPAC name is 1-cycloheptyl-3-(2,6-dimethylmorpholin-4-yl)-4-(4-methylphenyl)pyrrole-2,5-dione.
| Compound Name | 1-cycloheptyl-3-(2,6-dimethylmorpholin-4-yl)-4-(4-methylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110572643 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | 1-cycloheptyl-3-(2,6-dimethylmorpholin-4-yl)-4-(4-methylphenyl)pyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=C(N3CC(C)OC(C)C3)C(=O)N(C3CCCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C24H32N2O3/c1-16-10-12-19(13-11-16)21-22(25-14-17(2)29-18(3)15-25)24(28)26(23(21)27)20-8-6-4-5-7-9-20/h10-13,17-18,20H,4-9,14-15H2,1-3H3 |
| InChIKey | FSUKZMGXUJMFTB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|