C25H34N2O2 — CID 110572638
1-cycloheptyl-3-(3,5-dimethylpiperidin-1-yl)-4-(4-methylphenyl)pyrrole-2,5-dione (PubChem CID 110572638) has the molecular formula C25H34N2O2 and a molecular weight of 394.56 g/mol. Its IUPAC name is 1-cycloheptyl-3-(3,5-dimethylpiperidin-1-yl)-4-(4-methylphenyl)pyrrole-2,5-dione.
| Compound Name | 1-cycloheptyl-3-(3,5-dimethylpiperidin-1-yl)-4-(4-methylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110572638 |
| Molecular Formula | C25H34N2O2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | 1-cycloheptyl-3-(3,5-dimethylpiperidin-1-yl)-4-(4-methylphenyl)pyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=C(N3CC(C)CC(C)C3)C(=O)N(C3CCCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C25H34N2O2/c1-17-10-12-20(13-11-17)22-23(26-15-18(2)14-19(3)16-26)25(29)27(24(22)28)21-8-6-4-5-7-9-21/h10-13,18-19,21H,4-9,14-16H2,1-3H3 |
| InChIKey | JNIZAFAGCXQEDD-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|