C27H31FN2O3 — CID 110551680
3-(3,5-dimethylpiperidin-1-yl)-1-(2-fluorophenyl)-4-[4-(2-methylpropoxy)phenyl]pyrrole-2,5-dione (PubChem CID 110551680) has the molecular formula C27H31FN2O3 and a molecular weight of 450.55 g/mol. Its IUPAC name is 3-(3,5-dimethylpiperidin-1-yl)-1-(2-fluorophenyl)-4-[4-(2-methylpropoxy)phenyl]pyrrole-2,5-dione.
| Compound Name | 3-(3,5-dimethylpiperidin-1-yl)-1-(2-fluorophenyl)-4-[4-(2-methylpropoxy)phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110551680 |
| Molecular Formula | C27H31FN2O3 |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | 3-(3,5-dimethylpiperidin-1-yl)-1-(2-fluorophenyl)-4-[4-(2-methylpropoxy)phenyl]pyrrole-2,5-dione |
| SMILES | CC(C)COc1ccc(C2=C(N3CC(C)CC(C)C3)C(=O)N(c3ccccc3F)C2=O)cc1 |
| InChI | InChI=1S/C27H31FN2O3/c1-17(2)16-33-21-11-9-20(10-12-21)24-25(29-14-18(3)13-19(4)15-29)27(32)30(26(24)31)23-8-6-5-7-22(23)28/h5-12,17-19H,13-16H2,1-4H3 |
| InChIKey | CBXAJLGRARUMNM-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|