C23H23F2N3O3 — CID 110548089
1-(2,4-difluorophenyl)-3-(4-ethoxyphenyl)-4-(4-methylpiperazin-1-yl)pyrrole-2,5-dione (PubChem CID 110548089) has the molecular formula C23H23F2N3O3 and a molecular weight of 427.45 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(4-ethoxyphenyl)-4-(4-methylpiperazin-1-yl)pyrrole-2,5-dione.
| Compound Name | 1-(2,4-difluorophenyl)-3-(4-ethoxyphenyl)-4-(4-methylpiperazin-1-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110548089 |
| Molecular Formula | C23H23F2N3O3 |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(4-ethoxyphenyl)-4-(4-methylpiperazin-1-yl)pyrrole-2,5-dione |
| SMILES | CCOc1ccc(C2=C(N3CCN(C)CC3)C(=O)N(c3ccc(F)cc3F)C2=O)cc1 |
| InChI | InChI=1S/C23H23F2N3O3/c1-3-31-17-7-4-15(5-8-17)20-21(27-12-10-26(2)11-13-27)23(30)28(22(20)29)19-9-6-16(24)14-18(19)25/h4-9,14H,3,10-13H2,1-2H3 |
| InChIKey | STGXDWXZXYCCDV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|