C19H17F2N3O2S — CID 110555456
1-(2,4-difluorophenyl)-3-(4-methylpiperazin-1-yl)-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110555456) has the molecular formula C19H17F2N3O2S and a molecular weight of 389.43 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(4-methylpiperazin-1-yl)-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 1-(2,4-difluorophenyl)-3-(4-methylpiperazin-1-yl)-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110555456 |
| Molecular Formula | C19H17F2N3O2S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(4-methylpiperazin-1-yl)-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | CN1CCN(C2=C(c3cccs3)C(=O)N(c3ccc(F)cc3F)C2=O)CC1 |
| InChI | InChI=1S/C19H17F2N3O2S/c1-22-6-8-23(9-7-22)17-16(15-3-2-10-27-15)18(25)24(19(17)26)14-5-4-12(20)11-13(14)21/h2-5,10-11H,6-9H2,1H3 |
| InChIKey | CAIKXRYFUWKPHO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|