C22H16F2N2O2S — CID 110555461
3-[benzyl(methyl)amino]-1-(2,4-difluorophenyl)-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110555461) has the molecular formula C22H16F2N2O2S and a molecular weight of 410.45 g/mol. Its IUPAC name is 3-[benzyl(methyl)amino]-1-(2,4-difluorophenyl)-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 3-[benzyl(methyl)amino]-1-(2,4-difluorophenyl)-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110555461 |
| Molecular Formula | C22H16F2N2O2S |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 3-[benzyl(methyl)amino]-1-(2,4-difluorophenyl)-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | CN(Cc1ccccc1)C1=C(c2cccs2)C(=O)N(c2ccc(F)cc2F)C1=O |
| InChI | InChI=1S/C22H16F2N2O2S/c1-25(13-14-6-3-2-4-7-14)20-19(18-8-5-11-29-18)21(27)26(22(20)28)17-10-9-15(23)12-16(17)24/h2-12H,13H2,1H3 |
| InChIKey | LIMPEDWWIFVAOX-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|