C21H13ClF2N2O2S — CID 110592412
3-(5-chloro-2-methylanilino)-1-(2,4-difluorophenyl)-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110592412) has the molecular formula C21H13ClF2N2O2S and a molecular weight of 430.86 g/mol. Its IUPAC name is 3-(5-chloro-2-methylanilino)-1-(2,4-difluorophenyl)-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 3-(5-chloro-2-methylanilino)-1-(2,4-difluorophenyl)-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110592412 |
| Molecular Formula | C21H13ClF2N2O2S |
| Molecular Weight | 430.86 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | 3-(5-chloro-2-methylanilino)-1-(2,4-difluorophenyl)-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | Cc1ccc(Cl)cc1NC1=C(c2cccs2)C(=O)N(c2ccc(F)cc2F)C1=O |
| InChI | InChI=1S/C21H13ClF2N2O2S/c1-11-4-5-12(22)9-15(11)25-19-18(17-3-2-8-29-17)20(27)26(21(19)28)16-7-6-13(23)10-14(16)24/h2-10,25H,1H3 |
| InChIKey | OOEUBMHZYIOJPR-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.86 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|