C25H19ClF2N2O3 — CID 110588461
3-(5-chloro-2-methylanilino)-1-(2,4-difluorophenyl)-4-(4-ethoxyphenyl)pyrrole-2,5-dione (PubChem CID 110588461) has the molecular formula C25H19ClF2N2O3 and a molecular weight of 468.89 g/mol. Its IUPAC name is 3-(5-chloro-2-methylanilino)-1-(2,4-difluorophenyl)-4-(4-ethoxyphenyl)pyrrole-2,5-dione.
| Compound Name | 3-(5-chloro-2-methylanilino)-1-(2,4-difluorophenyl)-4-(4-ethoxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110588461 |
| Molecular Formula | C25H19ClF2N2O3 |
| Molecular Weight | 468.89 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 3-(5-chloro-2-methylanilino)-1-(2,4-difluorophenyl)-4-(4-ethoxyphenyl)pyrrole-2,5-dione |
| SMILES | CCOc1ccc(C2=C(Nc3cc(Cl)ccc3C)C(=O)N(c3ccc(F)cc3F)C2=O)cc1 |
| InChI | InChI=1S/C25H19ClF2N2O3/c1-3-33-18-9-5-15(6-10-18)22-23(29-20-12-16(26)7-4-14(20)2)25(32)30(24(22)31)21-11-8-17(27)13-19(21)28/h4-13,29H,3H2,1-2H3 |
| InChIKey | AKEPSLZCGGLOQW-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.89 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|