C27H25ClN2O3 — CID 110589336
3-(5-chloro-2-methylanilino)-4-(3,4-dimethylphenyl)-1-(2-ethoxyphenyl)pyrrole-2,5-dione (PubChem CID 110589336) has the molecular formula C27H25ClN2O3 and a molecular weight of 460.96 g/mol. Its IUPAC name is 3-(5-chloro-2-methylanilino)-4-(3,4-dimethylphenyl)-1-(2-ethoxyphenyl)pyrrole-2,5-dione.
| Compound Name | 3-(5-chloro-2-methylanilino)-4-(3,4-dimethylphenyl)-1-(2-ethoxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110589336 |
| Molecular Formula | C27H25ClN2O3 |
| Molecular Weight | 460.96 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 3-(5-chloro-2-methylanilino)-4-(3,4-dimethylphenyl)-1-(2-ethoxyphenyl)pyrrole-2,5-dione |
| SMILES | CCOc1ccccc1N1C(=O)C(Nc2cc(Cl)ccc2C)=C(c2ccc(C)c(C)c2)C1=O |
| InChI | InChI=1S/C27H25ClN2O3/c1-5-33-23-9-7-6-8-22(23)30-26(31)24(19-12-10-16(2)18(4)14-19)25(27(30)32)29-21-15-20(28)13-11-17(21)3/h6-15,29H,5H2,1-4H3 |
| InChIKey | TWACOWSOEAHAKW-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.96 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|