C20H20F2N2O4S — CID 110555499
3-[bis(2-methoxyethyl)amino]-1-(2,5-difluorophenyl)-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110555499) has the molecular formula C20H20F2N2O4S and a molecular weight of 422.45 g/mol. Its IUPAC name is 3-[bis(2-methoxyethyl)amino]-1-(2,5-difluorophenyl)-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 3-[bis(2-methoxyethyl)amino]-1-(2,5-difluorophenyl)-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110555499 |
| Molecular Formula | C20H20F2N2O4S |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 3-[bis(2-methoxyethyl)amino]-1-(2,5-difluorophenyl)-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | COCCN(CCOC)C1=C(c2cccs2)C(=O)N(c2cc(F)ccc2F)C1=O |
| InChI | InChI=1S/C20H20F2N2O4S/c1-27-9-7-23(8-10-28-2)18-17(16-4-3-11-29-16)19(25)24(20(18)26)15-12-13(21)5-6-14(15)22/h3-6,11-12H,7-10H2,1-2H3 |
| InChIKey | XJXYJMYYZNESKG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|