C26H24N2O2 — CID 110548758
1-benzyl-3-(3,4-dimethylphenyl)-4-(N-methylanilino)pyrrole-2,5-dione (PubChem CID 110548758) has the molecular formula C26H24N2O2 and a molecular weight of 396.49 g/mol. Its IUPAC name is 1-benzyl-3-(3,4-dimethylphenyl)-4-(N-methylanilino)pyrrole-2,5-dione.
| Compound Name | 1-benzyl-3-(3,4-dimethylphenyl)-4-(N-methylanilino)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110548758 |
| Molecular Formula | C26H24N2O2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 1-benzyl-3-(3,4-dimethylphenyl)-4-(N-methylanilino)pyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=C(N(C)c3ccccc3)C(=O)N(Cc3ccccc3)C2=O)cc1C |
| InChI | InChI=1S/C26H24N2O2/c1-18-14-15-21(16-19(18)2)23-24(27(3)22-12-8-5-9-13-22)26(30)28(25(23)29)17-20-10-6-4-7-11-20/h4-16H,17H2,1-3H3 |
| InChIKey | BORFUYMADFNTEK-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|