C18H24N2O4 — CID 110548995
3-(3,4-dimethylphenyl)-4-[2-hydroxyethyl(methyl)amino]-1-(2-methoxyethyl)pyrrole-2,5-dione (PubChem CID 110548995) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-4-[2-hydroxyethyl(methyl)amino]-1-(2-methoxyethyl)pyrrole-2,5-dione.
| Compound Name | 3-(3,4-dimethylphenyl)-4-[2-hydroxyethyl(methyl)amino]-1-(2-methoxyethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110548995 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-4-[2-hydroxyethyl(methyl)amino]-1-(2-methoxyethyl)pyrrole-2,5-dione |
| SMILES | COCCN1C(=O)C(c2ccc(C)c(C)c2)=C(N(C)CCO)C1=O |
| InChI | InChI=1S/C18H24N2O4/c1-12-5-6-14(11-13(12)2)15-16(19(3)7-9-21)18(23)20(17(15)22)8-10-24-4/h5-6,11,21H,7-10H2,1-4H3 |
| InChIKey | YVBPJNSXEZRVIT-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|