C22H23ClN2O4 — CID 110549801
1-(3-chloro-4-methoxyphenyl)-3-(3,4-dimethylphenyl)-4-[2-hydroxyethyl(methyl)amino]pyrrole-2,5-dione (PubChem CID 110549801) has the molecular formula C22H23ClN2O4 and a molecular weight of 414.89 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-3-(3,4-dimethylphenyl)-4-[2-hydroxyethyl(methyl)amino]pyrrole-2,5-dione.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-3-(3,4-dimethylphenyl)-4-[2-hydroxyethyl(methyl)amino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110549801 |
| Molecular Formula | C22H23ClN2O4 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-3-(3,4-dimethylphenyl)-4-[2-hydroxyethyl(methyl)amino]pyrrole-2,5-dione |
| SMILES | COc1ccc(N2C(=O)C(c3ccc(C)c(C)c3)=C(N(C)CCO)C2=O)cc1Cl |
| InChI | InChI=1S/C22H23ClN2O4/c1-13-5-6-15(11-14(13)2)19-20(24(3)9-10-26)22(28)25(21(19)27)16-7-8-18(29-4)17(23)12-16/h5-8,11-12,26H,9-10H2,1-4H3 |
| InChIKey | LRHOODOHNLNMDK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|