C19H15Cl3N2O3 — CID 110570769
3-(4-chlorophenyl)-1-(3,4-dichlorophenyl)-4-[2-hydroxyethyl(methyl)amino]pyrrole-2,5-dione (PubChem CID 110570769) has the molecular formula C19H15Cl3N2O3 and a molecular weight of 425.70 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-(3,4-dichlorophenyl)-4-[2-hydroxyethyl(methyl)amino]pyrrole-2,5-dione.
| Compound Name | 3-(4-chlorophenyl)-1-(3,4-dichlorophenyl)-4-[2-hydroxyethyl(methyl)amino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110570769 |
| Molecular Formula | C19H15Cl3N2O3 |
| Molecular Weight | 425.70 g/mol |
| Exact Mass | 424.01 |
| IUPAC Name | 3-(4-chlorophenyl)-1-(3,4-dichlorophenyl)-4-[2-hydroxyethyl(methyl)amino]pyrrole-2,5-dione |
| SMILES | CN(CCO)C1=C(c2ccc(Cl)cc2)C(=O)N(c2ccc(Cl)c(Cl)c2)C1=O |
| InChI | InChI=1S/C19H15Cl3N2O3/c1-23(8-9-25)17-16(11-2-4-12(20)5-3-11)18(26)24(19(17)27)13-6-7-14(21)15(22)10-13/h2-7,10,25H,8-9H2,1H3 |
| InChIKey | RXJWRHRHMGWRKS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.70 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|