C19H16Cl2N2O3 — CID 110562167
1-(2,5-dichlorophenyl)-3-[2-hydroxyethyl(methyl)amino]-4-phenylpyrrole-2,5-dione (PubChem CID 110562167) has the molecular formula C19H16Cl2N2O3 and a molecular weight of 391.25 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-3-[2-hydroxyethyl(methyl)amino]-4-phenylpyrrole-2,5-dione.
| Compound Name | 1-(2,5-dichlorophenyl)-3-[2-hydroxyethyl(methyl)amino]-4-phenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110562167 |
| Molecular Formula | C19H16Cl2N2O3 |
| Molecular Weight | 391.25 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-3-[2-hydroxyethyl(methyl)amino]-4-phenylpyrrole-2,5-dione |
| SMILES | CN(CCO)C1=C(c2ccccc2)C(=O)N(c2cc(Cl)ccc2Cl)C1=O |
| InChI | InChI=1S/C19H16Cl2N2O3/c1-22(9-10-24)17-16(12-5-3-2-4-6-12)18(25)23(19(17)26)15-11-13(20)7-8-14(15)21/h2-8,11,24H,9-10H2,1H3 |
| InChIKey | NMDFUDOECJHBCC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.25 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|