C23H23Cl2N3O2 — CID 110550918
1-(2,5-dichlorophenyl)-3-(3,4-dimethylphenyl)-4-(4-methylpiperazin-1-yl)pyrrole-2,5-dione (PubChem CID 110550918) has the molecular formula C23H23Cl2N3O2 and a molecular weight of 444.36 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-3-(3,4-dimethylphenyl)-4-(4-methylpiperazin-1-yl)pyrrole-2,5-dione.
| Compound Name | 1-(2,5-dichlorophenyl)-3-(3,4-dimethylphenyl)-4-(4-methylpiperazin-1-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110550918 |
| Molecular Formula | C23H23Cl2N3O2 |
| Molecular Weight | 444.36 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-3-(3,4-dimethylphenyl)-4-(4-methylpiperazin-1-yl)pyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=C(N3CCN(C)CC3)C(=O)N(c3cc(Cl)ccc3Cl)C2=O)cc1C |
| InChI | InChI=1S/C23H23Cl2N3O2/c1-14-4-5-16(12-15(14)2)20-21(27-10-8-26(3)9-11-27)23(30)28(22(20)29)19-13-17(24)6-7-18(19)25/h4-7,12-13H,8-11H2,1-3H3 |
| InChIKey | SRTRTPYGILKKAA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.36 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|