C23H26N4O4S — CID 110550263
4-[3-(3,4-dimethylphenyl)-4-(4-methylpiperazin-1-yl)-2,5-dioxopyrrol-1-yl]benzenesulfonamide (PubChem CID 110550263) has the molecular formula C23H26N4O4S and a molecular weight of 454.55 g/mol. Its IUPAC name is 4-[3-(3,4-dimethylphenyl)-4-(4-methylpiperazin-1-yl)-2,5-dioxopyrrol-1-yl]benzenesulfonamide.
| Compound Name | 4-[3-(3,4-dimethylphenyl)-4-(4-methylpiperazin-1-yl)-2,5-dioxopyrrol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 110550263 |
| Molecular Formula | C23H26N4O4S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 4-[3-(3,4-dimethylphenyl)-4-(4-methylpiperazin-1-yl)-2,5-dioxopyrrol-1-yl]benzenesulfonamide |
| SMILES | Cc1ccc(C2=C(N3CCN(C)CC3)C(=O)N(c3ccc(S(N)(=O)=O)cc3)C2=O)cc1C |
| InChI | InChI=1S/C23H26N4O4S/c1-15-4-5-17(14-16(15)2)20-21(26-12-10-25(3)11-13-26)23(29)27(22(20)28)18-6-8-19(9-7-18)32(24,30)31/h4-9,14H,10-13H2,1-3H3,(H2,24,30,31) |
| InChIKey | VVDCAXWJRVCXAK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 104.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|