C18H15F3N2O4S — CID 110551974
3-[2-hydroxyethyl(methyl)amino]-4-thiophen-2-yl-1-[4-(trifluoromethoxy)phenyl]pyrrole-2,5-dione (PubChem CID 110551974) has the molecular formula C18H15F3N2O4S and a molecular weight of 412.39 g/mol. Its IUPAC name is 3-[2-hydroxyethyl(methyl)amino]-4-thiophen-2-yl-1-[4-(trifluoromethoxy)phenyl]pyrrole-2,5-dione.
| Compound Name | 3-[2-hydroxyethyl(methyl)amino]-4-thiophen-2-yl-1-[4-(trifluoromethoxy)phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110551974 |
| Molecular Formula | C18H15F3N2O4S |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 3-[2-hydroxyethyl(methyl)amino]-4-thiophen-2-yl-1-[4-(trifluoromethoxy)phenyl]pyrrole-2,5-dione |
| SMILES | CN(CCO)C1=C(c2cccs2)C(=O)N(c2ccc(OC(F)(F)F)cc2)C1=O |
| InChI | InChI=1S/C18H15F3N2O4S/c1-22(8-9-24)15-14(13-3-2-10-28-13)16(25)23(17(15)26)11-4-6-12(7-5-11)27-18(19,20)21/h2-7,10,24H,8-9H2,1H3 |
| InChIKey | RUPAFBTWSMKFLP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|