C21H24N2O5S — CID 110555155
1-(3,4-diethoxyphenyl)-3-[2-hydroxyethyl(methyl)amino]-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110555155) has the molecular formula C21H24N2O5S and a molecular weight of 416.50 g/mol. Its IUPAC name is 1-(3,4-diethoxyphenyl)-3-[2-hydroxyethyl(methyl)amino]-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 1-(3,4-diethoxyphenyl)-3-[2-hydroxyethyl(methyl)amino]-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110555155 |
| Molecular Formula | C21H24N2O5S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 1-(3,4-diethoxyphenyl)-3-[2-hydroxyethyl(methyl)amino]-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | CCOc1ccc(N2C(=O)C(c3cccs3)=C(N(C)CCO)C2=O)cc1OCC |
| InChI | InChI=1S/C21H24N2O5S/c1-4-27-15-9-8-14(13-16(15)28-5-2)23-20(25)18(17-7-6-12-29-17)19(21(23)26)22(3)10-11-24/h6-9,12-13,24H,4-5,10-11H2,1-3H3 |
| InChIKey | DYXIXCYSQYOHQW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|