C23H21N3O5S — CID 110552745
1-(pyridin-3-ylmethyl)-3-thiophen-2-yl-4-(3,4,5-trimethoxyanilino)pyrrole-2,5-dione (PubChem CID 110552745) has the molecular formula C23H21N3O5S and a molecular weight of 451.50 g/mol. Its IUPAC name is 1-(pyridin-3-ylmethyl)-3-thiophen-2-yl-4-(3,4,5-trimethoxyanilino)pyrrole-2,5-dione.
| Compound Name | 1-(pyridin-3-ylmethyl)-3-thiophen-2-yl-4-(3,4,5-trimethoxyanilino)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110552745 |
| Molecular Formula | C23H21N3O5S |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | 1-(pyridin-3-ylmethyl)-3-thiophen-2-yl-4-(3,4,5-trimethoxyanilino)pyrrole-2,5-dione |
| SMILES | COc1cc(NC2=C(c3cccs3)C(=O)N(Cc3cccnc3)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C23H21N3O5S/c1-29-16-10-15(11-17(30-2)21(16)31-3)25-20-19(18-7-5-9-32-18)22(27)26(23(20)28)13-14-6-4-8-24-12-14/h4-12,25H,13H2,1-3H3 |
| InChIKey | NHFBZBMSTYXAHP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|