C23H17ClN2O2S — CID 110553995
1-(3-chloro-2-methylphenyl)-3-(2,3-dihydroindol-1-yl)-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110553995) has the molecular formula C23H17ClN2O2S and a molecular weight of 420.92 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-3-(2,3-dihydroindol-1-yl)-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 1-(3-chloro-2-methylphenyl)-3-(2,3-dihydroindol-1-yl)-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110553995 |
| Molecular Formula | C23H17ClN2O2S |
| Molecular Weight | 420.92 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-3-(2,3-dihydroindol-1-yl)-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | Cc1c(Cl)cccc1N1C(=O)C(c2cccs2)=C(N2CCc3ccccc32)C1=O |
| InChI | InChI=1S/C23H17ClN2O2S/c1-14-16(24)7-4-9-17(14)26-22(27)20(19-10-5-13-29-19)21(23(26)28)25-12-11-15-6-2-3-8-18(15)25/h2-10,13H,11-12H2,1H3 |
| InChIKey | ZURJEEVCYMXXME-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.92 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|