C23H19NO3S2 — CID 110555191
3-benzylsulfanyl-1-(2-methoxy-5-methylphenyl)-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110555191) has the molecular formula C23H19NO3S2 and a molecular weight of 421.54 g/mol. Its IUPAC name is 3-benzylsulfanyl-1-(2-methoxy-5-methylphenyl)-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 3-benzylsulfanyl-1-(2-methoxy-5-methylphenyl)-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110555191 |
| Molecular Formula | C23H19NO3S2 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | 3-benzylsulfanyl-1-(2-methoxy-5-methylphenyl)-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | COc1ccc(C)cc1N1C(=O)C(SCc2ccccc2)=C(c2cccs2)C1=O |
| InChI | InChI=1S/C23H19NO3S2/c1-15-10-11-18(27-2)17(13-15)24-22(25)20(19-9-6-12-28-19)21(23(24)26)29-14-16-7-4-3-5-8-16/h3-13H,14H2,1-2H3 |
| InChIKey | IPMFDNBGOIFYKR-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|