C22H22N2O3 — CID 110556828
3-(N-ethylanilino)-4-(4-methoxyphenyl)-1-prop-2-enylpyrrole-2,5-dione (PubChem CID 110556828) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is 3-(N-ethylanilino)-4-(4-methoxyphenyl)-1-prop-2-enylpyrrole-2,5-dione.
| Compound Name | 3-(N-ethylanilino)-4-(4-methoxyphenyl)-1-prop-2-enylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110556828 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 3-(N-ethylanilino)-4-(4-methoxyphenyl)-1-prop-2-enylpyrrole-2,5-dione |
| SMILES | C=CCN1C(=O)C(c2ccc(OC)cc2)=C(N(CC)c2ccccc2)C1=O |
| InChI | InChI=1S/C22H22N2O3/c1-4-15-24-21(25)19(16-11-13-18(27-3)14-12-16)20(22(24)26)23(5-2)17-9-7-6-8-10-17/h4,6-14H,1,5,15H2,2-3H3 |
| InChIKey | CIYWBPRDRPNTLK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|