C24H27N3O5 — CID 110558427
1-(3,5-dimethoxyphenyl)-3-[4-(2-hydroxyethyl)piperazin-1-yl]-4-phenylpyrrole-2,5-dione (PubChem CID 110558427) has the molecular formula C24H27N3O5 and a molecular weight of 437.50 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-3-[4-(2-hydroxyethyl)piperazin-1-yl]-4-phenylpyrrole-2,5-dione.
| Compound Name | 1-(3,5-dimethoxyphenyl)-3-[4-(2-hydroxyethyl)piperazin-1-yl]-4-phenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110558427 |
| Molecular Formula | C24H27N3O5 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-3-[4-(2-hydroxyethyl)piperazin-1-yl]-4-phenylpyrrole-2,5-dione |
| SMILES | COc1cc(OC)cc(N2C(=O)C(c3ccccc3)=C(N3CCN(CCO)CC3)C2=O)c1 |
| InChI | InChI=1S/C24H27N3O5/c1-31-19-14-18(15-20(16-19)32-2)27-23(29)21(17-6-4-3-5-7-17)22(24(27)30)26-10-8-25(9-11-26)12-13-28/h3-7,14-16,28H,8-13H2,1-2H3 |
| InChIKey | AIIYMKMGZWDOJO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|