C21H18N2O2 — CID 110560066
3-(2,3-dihydroindol-1-yl)-4-phenyl-1-prop-2-enylpyrrole-2,5-dione (PubChem CID 110560066) has the molecular formula C21H18N2O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is 3-(2,3-dihydroindol-1-yl)-4-phenyl-1-prop-2-enylpyrrole-2,5-dione.
| Compound Name | 3-(2,3-dihydroindol-1-yl)-4-phenyl-1-prop-2-enylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110560066 |
| Molecular Formula | C21H18N2O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 3-(2,3-dihydroindol-1-yl)-4-phenyl-1-prop-2-enylpyrrole-2,5-dione |
| SMILES | C=CCN1C(=O)C(c2ccccc2)=C(N2CCc3ccccc32)C1=O |
| InChI | InChI=1S/C21H18N2O2/c1-2-13-23-20(24)18(16-9-4-3-5-10-16)19(21(23)25)22-14-12-15-8-6-7-11-17(15)22/h2-11H,1,12-14H2 |
| InChIKey | JBTINARZGTVWDF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|