C18H20O3S — CID 11056188
S-ethyl (2R,3R)-3-hydroxy-3-phenyl-2-phenylmethoxypropanethioate (PubChem CID 11056188) has the molecular formula C18H20O3S and a molecular weight of 316.42 g/mol. Its IUPAC name is S-ethyl (2R,3R)-3-hydroxy-3-phenyl-2-phenylmethoxypropanethioate.
| Compound Name | S-ethyl (2R,3R)-3-hydroxy-3-phenyl-2-phenylmethoxypropanethioate |
|---|---|
| PubChem CID | 11056188 |
| Molecular Formula | C18H20O3S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | S-ethyl (2R,3R)-3-hydroxy-3-phenyl-2-phenylmethoxypropanethioate |
| SMILES | CCSC(=O)[C@H](OCc1ccccc1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C18H20O3S/c1-2-22-18(20)17(16(19)15-11-7-4-8-12-15)21-13-14-9-5-3-6-10-14/h3-12,16-17,19H,2,13H2,1H3/t16-,17-/m1/s1 |
| InChIKey | XIZMCCUQKPHBKM-IAGOWNOFSA-N |
| XLogP | 3.59 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|