C19H22O3S — CID 10758831
5-hydroxy-6-phenylmethoxy-3-phenylsulfanylhexan-2-one (PubChem CID 10758831) has the molecular formula C19H22O3S and a molecular weight of 330.45 g/mol. Its IUPAC name is 5-hydroxy-6-phenylmethoxy-3-phenylsulfanylhexan-2-one.
| Compound Name | 5-hydroxy-6-phenylmethoxy-3-phenylsulfanylhexan-2-one |
|---|---|
| PubChem CID | 10758831 |
| Molecular Formula | C19H22O3S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 5-hydroxy-6-phenylmethoxy-3-phenylsulfanylhexan-2-one |
| SMILES | CC(=O)C(CC(O)COCc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C19H22O3S/c1-15(20)19(23-18-10-6-3-7-11-18)12-17(21)14-22-13-16-8-4-2-5-9-16/h2-11,17,19,21H,12-14H2,1H3 |
| InChIKey | IYELKDKNTMHUTP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |