C23H33N3O6 — CID 110562772
N-[4-[4-[bis(2-methoxyethyl)amino]-2,5-dioxo-1-(2-propan-2-yloxyethyl)pyrrol-3-yl]phenyl]acetamide (PubChem CID 110562772) has the molecular formula C23H33N3O6 and a molecular weight of 447.53 g/mol. Its IUPAC name is N-[4-[4-[bis(2-methoxyethyl)amino]-2,5-dioxo-1-(2-propan-2-yloxyethyl)pyrrol-3-yl]phenyl]acetamide.
| Compound Name | N-[4-[4-[bis(2-methoxyethyl)amino]-2,5-dioxo-1-(2-propan-2-yloxyethyl)pyrrol-3-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 110562772 |
| Molecular Formula | C23H33N3O6 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | N-[4-[4-[bis(2-methoxyethyl)amino]-2,5-dioxo-1-(2-propan-2-yloxyethyl)pyrrol-3-yl]phenyl]acetamide |
| SMILES | COCCN(CCOC)C1=C(c2ccc(NC(C)=O)cc2)C(=O)N(CCOC(C)C)C1=O |
| InChI | InChI=1S/C23H33N3O6/c1-16(2)32-15-12-26-22(28)20(18-6-8-19(9-7-18)24-17(3)27)21(23(26)29)25(10-13-30-4)11-14-31-5/h6-9,16H,10-15H2,1-5H3,(H,24,27) |
| InChIKey | PQDCJSBOVYHLSR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|