C22H32N2O5 — CID 110556213
3-[bis(2-methoxyethyl)amino]-4-(4-methoxyphenyl)-1-pentylpyrrole-2,5-dione (PubChem CID 110556213) has the molecular formula C22H32N2O5 and a molecular weight of 404.51 g/mol. Its IUPAC name is 3-[bis(2-methoxyethyl)amino]-4-(4-methoxyphenyl)-1-pentylpyrrole-2,5-dione.
| Compound Name | 3-[bis(2-methoxyethyl)amino]-4-(4-methoxyphenyl)-1-pentylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110556213 |
| Molecular Formula | C22H32N2O5 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | 3-[bis(2-methoxyethyl)amino]-4-(4-methoxyphenyl)-1-pentylpyrrole-2,5-dione |
| SMILES | CCCCCN1C(=O)C(c2ccc(OC)cc2)=C(N(CCOC)CCOC)C1=O |
| InChI | InChI=1S/C22H32N2O5/c1-5-6-7-12-24-21(25)19(17-8-10-18(29-4)11-9-17)20(22(24)26)23(13-15-27-2)14-16-28-3/h8-11H,5-7,12-16H2,1-4H3 |
| InChIKey | KULWJFIWDCKFEZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|