C26H33N3O4 — CID 110576925
3-[ethyl(2-pyridin-4-ylethyl)amino]-1-(3-methoxypropyl)-4-(4-propoxyphenyl)pyrrole-2,5-dione (PubChem CID 110576925) has the molecular formula C26H33N3O4 and a molecular weight of 451.57 g/mol. Its IUPAC name is 3-[ethyl(2-pyridin-4-ylethyl)amino]-1-(3-methoxypropyl)-4-(4-propoxyphenyl)pyrrole-2,5-dione.
| Compound Name | 3-[ethyl(2-pyridin-4-ylethyl)amino]-1-(3-methoxypropyl)-4-(4-propoxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110576925 |
| Molecular Formula | C26H33N3O4 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | 3-[ethyl(2-pyridin-4-ylethyl)amino]-1-(3-methoxypropyl)-4-(4-propoxyphenyl)pyrrole-2,5-dione |
| SMILES | CCCOc1ccc(C2=C(N(CC)CCc3ccncc3)C(=O)N(CCCOC)C2=O)cc1 |
| InChI | InChI=1S/C26H33N3O4/c1-4-18-33-22-9-7-21(8-10-22)23-24(26(31)29(25(23)30)16-6-19-32-3)28(5-2)17-13-20-11-14-27-15-12-20/h7-12,14-15H,4-6,13,16-19H2,1-3H3 |
| InChIKey | MGGLHRYRJYNALL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|