C26H33N3O2 — CID 110572951
3-[ethyl(2-pyridin-4-ylethyl)amino]-1-hexyl-4-(4-methylphenyl)pyrrole-2,5-dione (PubChem CID 110572951) has the molecular formula C26H33N3O2 and a molecular weight of 419.57 g/mol. Its IUPAC name is 3-[ethyl(2-pyridin-4-ylethyl)amino]-1-hexyl-4-(4-methylphenyl)pyrrole-2,5-dione.
| Compound Name | 3-[ethyl(2-pyridin-4-ylethyl)amino]-1-hexyl-4-(4-methylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110572951 |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | 3-[ethyl(2-pyridin-4-ylethyl)amino]-1-hexyl-4-(4-methylphenyl)pyrrole-2,5-dione |
| SMILES | CCCCCCN1C(=O)C(c2ccc(C)cc2)=C(N(CC)CCc2ccncc2)C1=O |
| InChI | InChI=1S/C26H33N3O2/c1-4-6-7-8-18-29-25(30)23(22-11-9-20(3)10-12-22)24(26(29)31)28(5-2)19-15-21-13-16-27-17-14-21/h9-14,16-17H,4-8,15,18-19H2,1-3H3 |
| InChIKey | LFHCEVYHJBQIJQ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|