C25H23N5O4 — CID 110541184
3-[ethyl(2-pyridin-4-ylethyl)amino]-4-(4-nitrophenyl)-1-(pyridin-4-ylmethyl)pyrrole-2,5-dione (PubChem CID 110541184) has the molecular formula C25H23N5O4 and a molecular weight of 457.49 g/mol. Its IUPAC name is 3-[ethyl(2-pyridin-4-ylethyl)amino]-4-(4-nitrophenyl)-1-(pyridin-4-ylmethyl)pyrrole-2,5-dione.
| Compound Name | 3-[ethyl(2-pyridin-4-ylethyl)amino]-4-(4-nitrophenyl)-1-(pyridin-4-ylmethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110541184 |
| Molecular Formula | C25H23N5O4 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 3-[ethyl(2-pyridin-4-ylethyl)amino]-4-(4-nitrophenyl)-1-(pyridin-4-ylmethyl)pyrrole-2,5-dione |
| SMILES | CCN(CCc1ccncc1)C1=C(c2ccc([N+](=O)[O-])cc2)C(=O)N(Cc2ccncc2)C1=O |
| InChI | InChI=1S/C25H23N5O4/c1-2-28(16-11-18-7-12-26-13-8-18)23-22(20-3-5-21(6-4-20)30(33)34)24(31)29(25(23)32)17-19-9-14-27-15-10-19/h3-10,12-15H,2,11,16-17H2,1H3 |
| InChIKey | DMLOETREQIPUOO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 109.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|