C29H31N3O2 — CID 110548396
3-(3,4-dimethylphenyl)-4-[ethyl(2-pyridin-4-ylethyl)amino]-1-(2-phenylethyl)pyrrole-2,5-dione (PubChem CID 110548396) has the molecular formula C29H31N3O2 and a molecular weight of 453.59 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-4-[ethyl(2-pyridin-4-ylethyl)amino]-1-(2-phenylethyl)pyrrole-2,5-dione.
| Compound Name | 3-(3,4-dimethylphenyl)-4-[ethyl(2-pyridin-4-ylethyl)amino]-1-(2-phenylethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110548396 |
| Molecular Formula | C29H31N3O2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-4-[ethyl(2-pyridin-4-ylethyl)amino]-1-(2-phenylethyl)pyrrole-2,5-dione |
| SMILES | CCN(CCc1ccncc1)C1=C(c2ccc(C)c(C)c2)C(=O)N(CCc2ccccc2)C1=O |
| InChI | InChI=1S/C29H31N3O2/c1-4-31(18-14-24-12-16-30-17-13-24)27-26(25-11-10-21(2)22(3)20-25)28(33)32(29(27)34)19-15-23-8-6-5-7-9-23/h5-13,16-17,20H,4,14-15,18-19H2,1-3H3 |
| InChIKey | GXYJAOPRJJMGNN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|