C27H26FN3O2 — CID 110549861
3-(3,4-dimethylphenyl)-4-[ethyl(2-pyridin-4-ylethyl)amino]-1-(2-fluorophenyl)pyrrole-2,5-dione (PubChem CID 110549861) has the molecular formula C27H26FN3O2 and a molecular weight of 443.52 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-4-[ethyl(2-pyridin-4-ylethyl)amino]-1-(2-fluorophenyl)pyrrole-2,5-dione.
| Compound Name | 3-(3,4-dimethylphenyl)-4-[ethyl(2-pyridin-4-ylethyl)amino]-1-(2-fluorophenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110549861 |
| Molecular Formula | C27H26FN3O2 |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-4-[ethyl(2-pyridin-4-ylethyl)amino]-1-(2-fluorophenyl)pyrrole-2,5-dione |
| SMILES | CCN(CCc1ccncc1)C1=C(c2ccc(C)c(C)c2)C(=O)N(c2ccccc2F)C1=O |
| InChI | InChI=1S/C27H26FN3O2/c1-4-30(16-13-20-11-14-29-15-12-20)25-24(21-10-9-18(2)19(3)17-21)26(32)31(27(25)33)23-8-6-5-7-22(23)28/h5-12,14-15,17H,4,13,16H2,1-3H3 |
| InChIKey | LLBBGUXGDXOYKD-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|