C27H27N3O3 — CID 110558119
3-[ethyl(2-pyridin-4-ylethyl)amino]-4-(4-methoxyphenyl)-1-(2-methylphenyl)pyrrole-2,5-dione (PubChem CID 110558119) has the molecular formula C27H27N3O3 and a molecular weight of 441.53 g/mol. Its IUPAC name is 3-[ethyl(2-pyridin-4-ylethyl)amino]-4-(4-methoxyphenyl)-1-(2-methylphenyl)pyrrole-2,5-dione.
| Compound Name | 3-[ethyl(2-pyridin-4-ylethyl)amino]-4-(4-methoxyphenyl)-1-(2-methylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110558119 |
| Molecular Formula | C27H27N3O3 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | 3-[ethyl(2-pyridin-4-ylethyl)amino]-4-(4-methoxyphenyl)-1-(2-methylphenyl)pyrrole-2,5-dione |
| SMILES | CCN(CCc1ccncc1)C1=C(c2ccc(OC)cc2)C(=O)N(c2ccccc2C)C1=O |
| InChI | InChI=1S/C27H27N3O3/c1-4-29(18-15-20-13-16-28-17-14-20)25-24(21-9-11-22(33-3)12-10-21)26(31)30(27(25)32)23-8-6-5-7-19(23)2/h5-14,16-17H,4,15,18H2,1-3H3 |
| InChIKey | WUHOCOGIRJMKFC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|