C28H29N3O2 — CID 110573340
1-(3,5-dimethylphenyl)-3-[ethyl(2-pyridin-4-ylethyl)amino]-4-(4-methylphenyl)pyrrole-2,5-dione (PubChem CID 110573340) has the molecular formula C28H29N3O2 and a molecular weight of 439.56 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-[ethyl(2-pyridin-4-ylethyl)amino]-4-(4-methylphenyl)pyrrole-2,5-dione.
| Compound Name | 1-(3,5-dimethylphenyl)-3-[ethyl(2-pyridin-4-ylethyl)amino]-4-(4-methylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110573340 |
| Molecular Formula | C28H29N3O2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-[ethyl(2-pyridin-4-ylethyl)amino]-4-(4-methylphenyl)pyrrole-2,5-dione |
| SMILES | CCN(CCc1ccncc1)C1=C(c2ccc(C)cc2)C(=O)N(c2cc(C)cc(C)c2)C1=O |
| InChI | InChI=1S/C28H29N3O2/c1-5-30(15-12-22-10-13-29-14-11-22)26-25(23-8-6-19(2)7-9-23)27(32)31(28(26)33)24-17-20(3)16-21(4)18-24/h6-11,13-14,16-18H,5,12,15H2,1-4H3 |
| InChIKey | SJOUNZQAALBDHV-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|