C26H21FN4O2 — CID 110545834
4-[3-[ethyl(2-pyridin-4-ylethyl)amino]-4-(4-fluorophenyl)-2,5-dioxopyrrol-1-yl]benzonitrile (PubChem CID 110545834) has the molecular formula C26H21FN4O2 and a molecular weight of 440.48 g/mol. Its IUPAC name is 4-[3-[ethyl(2-pyridin-4-ylethyl)amino]-4-(4-fluorophenyl)-2,5-dioxopyrrol-1-yl]benzonitrile.
| Compound Name | 4-[3-[ethyl(2-pyridin-4-ylethyl)amino]-4-(4-fluorophenyl)-2,5-dioxopyrrol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 110545834 |
| Molecular Formula | C26H21FN4O2 |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 4-[3-[ethyl(2-pyridin-4-ylethyl)amino]-4-(4-fluorophenyl)-2,5-dioxopyrrol-1-yl]benzonitrile |
| SMILES | CCN(CCc1ccncc1)C1=C(c2ccc(F)cc2)C(=O)N(c2ccc(C#N)cc2)C1=O |
| InChI | InChI=1S/C26H21FN4O2/c1-2-30(16-13-18-11-14-29-15-12-18)24-23(20-5-7-21(27)8-6-20)25(32)31(26(24)33)22-9-3-19(17-28)4-10-22/h3-12,14-15H,2,13,16H2,1H3 |
| InChIKey | VPUBWTOVLMGGSS-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 77.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|