C17H9FN2O3 — CID 110582986
4-[3-(4-fluorophenyl)-4-hydroxy-2,5-dioxopyrrol-1-yl]benzonitrile (PubChem CID 110582986) has the molecular formula C17H9FN2O3 and a molecular weight of 308.27 g/mol. Its IUPAC name is 4-[3-(4-fluorophenyl)-4-hydroxy-2,5-dioxopyrrol-1-yl]benzonitrile.
| Compound Name | 4-[3-(4-fluorophenyl)-4-hydroxy-2,5-dioxopyrrol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 110582986 |
| Molecular Formula | C17H9FN2O3 |
| Molecular Weight | 308.27 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 4-[3-(4-fluorophenyl)-4-hydroxy-2,5-dioxopyrrol-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2C(=O)C(O)=C(c3ccc(F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C17H9FN2O3/c18-12-5-3-11(4-6-12)14-15(21)17(23)20(16(14)22)13-7-1-10(9-19)2-8-13/h1-8,21H |
| InChIKey | SYQDDXPSGJXCBD-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|