C20H18FNO5 — CID 110582980
1-(3,4-diethoxyphenyl)-3-(4-fluorophenyl)-4-hydroxypyrrole-2,5-dione (PubChem CID 110582980) has the molecular formula C20H18FNO5 and a molecular weight of 371.36 g/mol. Its IUPAC name is 1-(3,4-diethoxyphenyl)-3-(4-fluorophenyl)-4-hydroxypyrrole-2,5-dione.
| Compound Name | 1-(3,4-diethoxyphenyl)-3-(4-fluorophenyl)-4-hydroxypyrrole-2,5-dione |
|---|---|
| PubChem CID | 110582980 |
| Molecular Formula | C20H18FNO5 |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 1-(3,4-diethoxyphenyl)-3-(4-fluorophenyl)-4-hydroxypyrrole-2,5-dione |
| SMILES | CCOc1ccc(N2C(=O)C(O)=C(c3ccc(F)cc3)C2=O)cc1OCC |
| InChI | InChI=1S/C20H18FNO5/c1-3-26-15-10-9-14(11-16(15)27-4-2)22-19(24)17(18(23)20(22)25)12-5-7-13(21)8-6-12/h5-11,23H,3-4H2,1-2H3 |
| InChIKey | WYZYKXSLQVAVQD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|