C19H14F3NO5 — CID 110583267
3-(4-ethoxyphenyl)-4-hydroxy-1-[4-(trifluoromethoxy)phenyl]pyrrole-2,5-dione (PubChem CID 110583267) has the molecular formula C19H14F3NO5 and a molecular weight of 393.32 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)-4-hydroxy-1-[4-(trifluoromethoxy)phenyl]pyrrole-2,5-dione.
| Compound Name | 3-(4-ethoxyphenyl)-4-hydroxy-1-[4-(trifluoromethoxy)phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110583267 |
| Molecular Formula | C19H14F3NO5 |
| Molecular Weight | 393.32 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 3-(4-ethoxyphenyl)-4-hydroxy-1-[4-(trifluoromethoxy)phenyl]pyrrole-2,5-dione |
| SMILES | CCOc1ccc(C2=C(O)C(=O)N(c3ccc(OC(F)(F)F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C19H14F3NO5/c1-2-27-13-7-3-11(4-8-13)15-16(24)18(26)23(17(15)25)12-5-9-14(10-6-12)28-19(20,21)22/h3-10,24H,2H2,1H3 |
| InChIKey | DNLLLHYOWAFWTI-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.32 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|